C14H13ClF3N5O — CID 165380975
4-(2-azidopropan-2-yl)-6-chloro-1-(1,1,1-trifluoropropan-2-yloxy)-2,7-naphthyridine (PubChem CID 165380975) has the molecular formula C14H13ClF3N5O and a molecular weight of 359.74 g/mol. Its IUPAC name is 4-(2-azidopropan-2-yl)-6-chloro-1-(1,1,1-trifluoropropan-2-yloxy)-2,7-naphthyridine.
| Compound Name | 4-(2-azidopropan-2-yl)-6-chloro-1-(1,1,1-trifluoropropan-2-yloxy)-2,7-naphthyridine |
|---|---|
| PubChem CID | 165380975 |
| Molecular Formula | C14H13ClF3N5O |
| Molecular Weight | 359.74 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 4-(2-azidopropan-2-yl)-6-chloro-1-(1,1,1-trifluoropropan-2-yloxy)-2,7-naphthyridine |
| SMILES | CC(Oc1ncc(C(C)(C)N=[N+]=[N-])c2cc(Cl)ncc12)C(F)(F)F |
| InChI | InChI=1S/C14H13ClF3N5O/c1-7(14(16,17)18)24-12-9-5-20-11(15)4-8(9)10(6-21-12)13(2,3)22-23-19/h4-7H,1-3H3 |
| InChIKey | HHUTWKQHDDJKFZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 83.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.74 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|