C19H24ClN5OS — CID 166483387
4-[(2R)-2-azidobutan-2-yl]-6-chloro-1-(4-cyclopropylsulfanylbutan-2-yloxy)-2,7-naphthyridine (PubChem CID 166483387) has the molecular formula C19H24ClN5OS and a molecular weight of 405.96 g/mol. Its IUPAC name is 4-[(2R)-2-azidobutan-2-yl]-6-chloro-1-(4-cyclopropylsulfanylbutan-2-yloxy)-2,7-naphthyridine.
| Compound Name | 4-[(2R)-2-azidobutan-2-yl]-6-chloro-1-(4-cyclopropylsulfanylbutan-2-yloxy)-2,7-naphthyridine |
|---|---|
| PubChem CID | 166483387 |
| Molecular Formula | C19H24ClN5OS |
| Molecular Weight | 405.96 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 4-[(2R)-2-azidobutan-2-yl]-6-chloro-1-(4-cyclopropylsulfanylbutan-2-yloxy)-2,7-naphthyridine |
| SMILES | CC[C@@](C)(N=[N+]=[N-])c1cnc(OC(C)CCSC2CC2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C19H24ClN5OS/c1-4-19(3,24-25-21)16-11-23-18(15-10-22-17(20)9-14(15)16)26-12(2)7-8-27-13-5-6-13/h9-13H,4-8H2,1-3H3/t12?,19-/m1/s1 |
| InChIKey | XXHJCDCMOKGLCR-FKWGRNQDSA-N |
| XLogP | 6.27 |
| TPSA | 83.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.96 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|