C16H20ClN3O — CID 167261605
(2R)-2-[6-chloro-1-(1-methylcyclopropyl)oxy-2,7-naphthyridin-4-yl]butan-2-amine (PubChem CID 167261605) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is (2R)-2-[6-chloro-1-(1-methylcyclopropyl)oxy-2,7-naphthyridin-4-yl]butan-2-amine.
| Compound Name | (2R)-2-[6-chloro-1-(1-methylcyclopropyl)oxy-2,7-naphthyridin-4-yl]butan-2-amine |
|---|---|
| PubChem CID | 167261605 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (2R)-2-[6-chloro-1-(1-methylcyclopropyl)oxy-2,7-naphthyridin-4-yl]butan-2-amine |
| SMILES | CC[C@@](C)(N)c1cnc(OC2(C)CC2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C16H20ClN3O/c1-4-16(3,18)12-9-20-14(21-15(2)5-6-15)11-8-19-13(17)7-10(11)12/h7-9H,4-6,18H2,1-3H3/t16-/m1/s1 |
| InChIKey | CQIZGAUXOOXIAJ-MRXNPFEDSA-N |
| XLogP | 3.80 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|