C15H17ClFN3O — CID 167261460
2-[6-chloro-1-[(1-fluorocyclopropyl)methoxy]-2,7-naphthyridin-4-yl]propan-2-amine (PubChem CID 167261460) has the molecular formula C15H17ClFN3O and a molecular weight of 309.77 g/mol. Its IUPAC name is 2-[6-chloro-1-[(1-fluorocyclopropyl)methoxy]-2,7-naphthyridin-4-yl]propan-2-amine.
| Compound Name | 2-[6-chloro-1-[(1-fluorocyclopropyl)methoxy]-2,7-naphthyridin-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 167261460 |
| Molecular Formula | C15H17ClFN3O |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[6-chloro-1-[(1-fluorocyclopropyl)methoxy]-2,7-naphthyridin-4-yl]propan-2-amine |
| SMILES | CC(C)(N)c1cnc(OCC2(F)CC2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C15H17ClFN3O/c1-14(2,18)11-7-20-13(21-8-15(17)3-4-15)10-6-19-12(16)5-9(10)11/h5-7H,3-4,8,18H2,1-2H3 |
| InChIKey | XYEAGACTMSSDKS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|