C16H20ClN3O2S — CID 166483706
2-[6-chloro-1-(3-methylsulfinylcyclobutyl)oxy-2,7-naphthyridin-4-yl]propan-2-amine (PubChem CID 166483706) has the molecular formula C16H20ClN3O2S and a molecular weight of 353.88 g/mol. Its IUPAC name is 2-[6-chloro-1-(3-methylsulfinylcyclobutyl)oxy-2,7-naphthyridin-4-yl]propan-2-amine.
| Compound Name | 2-[6-chloro-1-(3-methylsulfinylcyclobutyl)oxy-2,7-naphthyridin-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 166483706 |
| Molecular Formula | C16H20ClN3O2S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-[6-chloro-1-(3-methylsulfinylcyclobutyl)oxy-2,7-naphthyridin-4-yl]propan-2-amine |
| SMILES | CS(=O)C1CC(Oc2ncc(C(C)(C)N)c3cc(Cl)ncc23)C1 |
| InChI | InChI=1S/C16H20ClN3O2S/c1-16(2,18)13-8-20-15(12-7-19-14(17)6-11(12)13)22-9-4-10(5-9)23(3)21/h6-10H,4-5,18H2,1-3H3 |
| InChIKey | WBSYYXJRLLCKRT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|