C16H20ClN3O2 — CID 165380828
2-[2-(6-chloro-1-cyclopropyloxy-2,7-naphthyridin-4-yl)propan-2-ylamino]ethanol (PubChem CID 165380828) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 2-[2-(6-chloro-1-cyclopropyloxy-2,7-naphthyridin-4-yl)propan-2-ylamino]ethanol.
| Compound Name | 2-[2-(6-chloro-1-cyclopropyloxy-2,7-naphthyridin-4-yl)propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 165380828 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-[2-(6-chloro-1-cyclopropyloxy-2,7-naphthyridin-4-yl)propan-2-ylamino]ethanol |
| SMILES | CC(C)(NCCO)c1cnc(OC2CC2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C16H20ClN3O2/c1-16(2,20-5-6-21)13-9-19-15(22-10-3-4-10)12-8-18-14(17)7-11(12)13/h7-10,20-21H,3-6H2,1-2H3 |
| InChIKey | UBRSBJOYGOIMOC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|