C17H20ClN3O3 — CID 166506492
methyl 2-[2-(7-chloro-4-cyclopropyloxy-2,6-naphthyridin-1-yl)propan-2-ylamino]acetate (PubChem CID 166506492) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is methyl 2-[2-(7-chloro-4-cyclopropyloxy-2,6-naphthyridin-1-yl)propan-2-ylamino]acetate.
| Compound Name | methyl 2-[2-(7-chloro-4-cyclopropyloxy-2,6-naphthyridin-1-yl)propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 166506492 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | methyl 2-[2-(7-chloro-4-cyclopropyloxy-2,6-naphthyridin-1-yl)propan-2-ylamino]acetate |
| SMILES | COC(=O)CNC(C)(C)c1ncc(OC2CC2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C17H20ClN3O3/c1-17(2,21-9-15(22)23-3)16-11-6-14(18)19-7-12(11)13(8-20-16)24-10-4-5-10/h6-8,10,21H,4-5,9H2,1-3H3 |
| InChIKey | ZQSAPCSIKGICPV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|