C19H30ClN3OS — CID 166483791
1-(6-chloro-1-cyclobutyloxy-2,7-naphthyridin-4-yl)propan-1-amine;ethane;methylsulfanylmethane (PubChem CID 166483791) has the molecular formula C19H30ClN3OS and a molecular weight of 383.99 g/mol. Its IUPAC name is 1-(6-chloro-1-cyclobutyloxy-2,7-naphthyridin-4-yl)propan-1-amine;ethane;methylsulfanylmethane.
| Compound Name | 1-(6-chloro-1-cyclobutyloxy-2,7-naphthyridin-4-yl)propan-1-amine;ethane;methylsulfanylmethane |
|---|---|
| PubChem CID | 166483791 |
| Molecular Formula | C19H30ClN3OS |
| Molecular Weight | 383.99 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-(6-chloro-1-cyclobutyloxy-2,7-naphthyridin-4-yl)propan-1-amine;ethane;methylsulfanylmethane |
| SMILES | CC.CCC(N)c1cnc(OC2CCC2)c2cnc(Cl)cc12.CSC |
| InChI | InChI=1S/C15H18ClN3O.C2H6S.C2H6/c1-2-13(17)11-7-19-15(20-9-4-3-5-9)12-8-18-14(16)6-10(11)12;1-3-2;1-2/h6-9,13H,2-5,17H2,1H3;1-2H3;1-2H3 |
| InChIKey | TUYLILMFDKHEQX-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.99 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|