C18H30ClN3O2S — CID 166483396
1-[6-chloro-1-(3-methylsulfanylpropoxy)-2,7-naphthyridin-4-yl]propan-1-amine;ethane;methanol (PubChem CID 166483396) has the molecular formula C18H30ClN3O2S and a molecular weight of 387.98 g/mol. Its IUPAC name is 1-[6-chloro-1-(3-methylsulfanylpropoxy)-2,7-naphthyridin-4-yl]propan-1-amine;ethane;methanol.
| Compound Name | 1-[6-chloro-1-(3-methylsulfanylpropoxy)-2,7-naphthyridin-4-yl]propan-1-amine;ethane;methanol |
|---|---|
| PubChem CID | 166483396 |
| Molecular Formula | C18H30ClN3O2S |
| Molecular Weight | 387.98 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-[6-chloro-1-(3-methylsulfanylpropoxy)-2,7-naphthyridin-4-yl]propan-1-amine;ethane;methanol |
| SMILES | CC.CCC(N)c1cnc(OCCCSC)c2cnc(Cl)cc12.CO |
| InChI | InChI=1S/C15H20ClN3OS.C2H6.CH4O/c1-3-13(17)11-8-19-15(20-5-4-6-21-2)12-9-18-14(16)7-10(11)12;2*1-2/h7-9,13H,3-6,17H2,1-2H3;1-2H3;2H,1H3 |
| InChIKey | VVAKHNLILRBSRR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.98 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|