C16H23ClN4O2S — CID 166483961
N-[4-[[4-(aminomethyl)-6-chloro-2,7-naphthyridin-1-yl]oxy]butan-2-yloxysulfanyl]-N-methylethanamine (PubChem CID 166483961) has the molecular formula C16H23ClN4O2S and a molecular weight of 370.91 g/mol. Its IUPAC name is N-[4-[[4-(aminomethyl)-6-chloro-2,7-naphthyridin-1-yl]oxy]butan-2-yloxysulfanyl]-N-methylethanamine.
| Compound Name | N-[4-[[4-(aminomethyl)-6-chloro-2,7-naphthyridin-1-yl]oxy]butan-2-yloxysulfanyl]-N-methylethanamine |
|---|---|
| PubChem CID | 166483961 |
| Molecular Formula | C16H23ClN4O2S |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[4-[[4-(aminomethyl)-6-chloro-2,7-naphthyridin-1-yl]oxy]butan-2-yloxysulfanyl]-N-methylethanamine |
| SMILES | CCN(C)SOC(C)CCOc1ncc(CN)c2cc(Cl)ncc12 |
| InChI | InChI=1S/C16H23ClN4O2S/c1-4-21(3)24-23-11(2)5-6-22-16-14-10-19-15(17)7-13(14)12(8-18)9-20-16/h7,9-11H,4-6,8,18H2,1-3H3 |
| InChIKey | JJISNZCBRDMASN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|