C16H22ClN3OS — CID 166483385
1-[6-chloro-1-(3-methylsulfanylbutoxy)-2,7-naphthyridin-4-yl]propan-1-amine (PubChem CID 166483385) has the molecular formula C16H22ClN3OS and a molecular weight of 339.89 g/mol. Its IUPAC name is 1-[6-chloro-1-(3-methylsulfanylbutoxy)-2,7-naphthyridin-4-yl]propan-1-amine.
| Compound Name | 1-[6-chloro-1-(3-methylsulfanylbutoxy)-2,7-naphthyridin-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 166483385 |
| Molecular Formula | C16H22ClN3OS |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-[6-chloro-1-(3-methylsulfanylbutoxy)-2,7-naphthyridin-4-yl]propan-1-amine |
| SMILES | CCC(N)c1cnc(OCCC(C)SC)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C16H22ClN3OS/c1-4-14(18)12-8-20-16(21-6-5-10(2)22-3)13-9-19-15(17)7-11(12)13/h7-10,14H,4-6,18H2,1-3H3 |
| InChIKey | SRRIPDKSXKFNQS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|