C18H20ClN5O3S — CID 166483602
4-(1-azido-1-cyclopropylethyl)-6-chloro-1-(3-methylsulfonylcyclobutyl)oxy-2,7-naphthyridine (PubChem CID 166483602) has the molecular formula C18H20ClN5O3S and a molecular weight of 421.91 g/mol. Its IUPAC name is 4-(1-azido-1-cyclopropylethyl)-6-chloro-1-(3-methylsulfonylcyclobutyl)oxy-2,7-naphthyridine.
| Compound Name | 4-(1-azido-1-cyclopropylethyl)-6-chloro-1-(3-methylsulfonylcyclobutyl)oxy-2,7-naphthyridine |
|---|---|
| PubChem CID | 166483602 |
| Molecular Formula | C18H20ClN5O3S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 4-(1-azido-1-cyclopropylethyl)-6-chloro-1-(3-methylsulfonylcyclobutyl)oxy-2,7-naphthyridine |
| SMILES | CC(N=[N+]=[N-])(c1cnc(OC2CC(S(C)(=O)=O)C2)c2cnc(Cl)cc12)C1CC1 |
| InChI | InChI=1S/C18H20ClN5O3S/c1-18(23-24-20,10-3-4-10)15-9-22-17(14-8-21-16(19)7-13(14)15)27-11-5-12(6-11)28(2,25)26/h7-12H,3-6H2,1-2H3 |
| InChIKey | PGRFWCCRTOXMLD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 117.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|