C20H28ClN3O4S2 — CID 175588956
tert-butyl-[1-[6-chloro-1-(3-methylsulfonylcyclobutyl)oxy-2,7-naphthyridin-4-yl]propylamino]-oxidosulfanium (PubChem CID 175588956) has the molecular formula C20H28ClN3O4S2 and a molecular weight of 474.05 g/mol. Its IUPAC name is tert-butyl-[1-[6-chloro-1-(3-methylsulfonylcyclobutyl)oxy-2,7-naphthyridin-4-yl]propylamino]-oxidosulfanium.
| Compound Name | tert-butyl-[1-[6-chloro-1-(3-methylsulfonylcyclobutyl)oxy-2,7-naphthyridin-4-yl]propylamino]-oxidosulfanium |
|---|---|
| PubChem CID | 175588956 |
| Molecular Formula | C20H28ClN3O4S2 |
| Molecular Weight | 474.05 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | tert-butyl-[1-[6-chloro-1-(3-methylsulfonylcyclobutyl)oxy-2,7-naphthyridin-4-yl]propylamino]-oxidosulfanium |
| SMILES | CCC(N[S+]([O-])C(C)(C)C)c1cnc(OC2CC(S(C)(=O)=O)C2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C20H28ClN3O4S2/c1-6-17(24-29(25)20(2,3)4)15-10-23-19(16-11-22-18(21)9-14(15)16)28-12-7-13(8-12)30(5,26)27/h9-13,17,24H,6-8H2,1-5H3 |
| InChIKey | YBNKIDDYGABSPQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 104.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.05 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|