C19H24ClN3O4S2 — CID 176597313
(E)-4-[6-chloro-1-(3-ethylsulfonylcyclobutyl)oxy-2,7-naphthyridin-4-yl]-2-methylbut-3-ene-2-sulfinamide (PubChem CID 176597313) has the molecular formula C19H24ClN3O4S2 and a molecular weight of 458.01 g/mol. Its IUPAC name is (E)-4-[6-chloro-1-(3-ethylsulfonylcyclobutyl)oxy-2,7-naphthyridin-4-yl]-2-methylbut-3-ene-2-sulfinamide.
| Compound Name | (E)-4-[6-chloro-1-(3-ethylsulfonylcyclobutyl)oxy-2,7-naphthyridin-4-yl]-2-methylbut-3-ene-2-sulfinamide |
|---|---|
| PubChem CID | 176597313 |
| Molecular Formula | C19H24ClN3O4S2 |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | (E)-4-[6-chloro-1-(3-ethylsulfonylcyclobutyl)oxy-2,7-naphthyridin-4-yl]-2-methylbut-3-ene-2-sulfinamide |
| SMILES | CCS(=O)(=O)C1CC(Oc2ncc(/C=C/C(C)(C)S(N)=O)c3cc(Cl)ncc23)C1 |
| InChI | InChI=1S/C19H24ClN3O4S2/c1-4-29(25,26)14-7-13(8-14)27-18-16-11-22-17(20)9-15(16)12(10-23-18)5-6-19(2,3)28(21)24/h5-6,9-11,13-14H,4,7-8,21H2,1-3H3/b6-5+ |
| InChIKey | HILVVYASHTWXTB-AATRIKPKSA-N |
| XLogP | 3.04 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|