C21H30ClN3O4S2 — CID 166483423
(S)-N-[(1S)-1-[6-chloro-1-(3-methylsulfonylcyclobutyl)oxy-2,7-naphthyridin-4-yl]butyl]-2-methylpropane-2-sulfinamide (PubChem CID 166483423) has the molecular formula C21H30ClN3O4S2 and a molecular weight of 488.08 g/mol. Its IUPAC name is (S)-N-[(1S)-1-[6-chloro-1-(3-methylsulfonylcyclobutyl)oxy-2,7-naphthyridin-4-yl]butyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1S)-1-[6-chloro-1-(3-methylsulfonylcyclobutyl)oxy-2,7-naphthyridin-4-yl]butyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 166483423 |
| Molecular Formula | C21H30ClN3O4S2 |
| Molecular Weight | 488.08 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | (S)-N-[(1S)-1-[6-chloro-1-(3-methylsulfonylcyclobutyl)oxy-2,7-naphthyridin-4-yl]butyl]-2-methylpropane-2-sulfinamide |
| SMILES | CCC[C@H](N[S@@](=O)C(C)(C)C)c1cnc(OC2CC(S(C)(=O)=O)C2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C21H30ClN3O4S2/c1-6-7-18(25-30(26)21(2,3)4)16-11-24-20(17-12-23-19(22)10-15(16)17)29-13-8-14(9-13)31(5,27)28/h10-14,18,25H,6-9H2,1-5H3/t13?,14?,18-,30-/m0/s1 |
| InChIKey | DFRGZAPUMDPNTG-ZKJXZYGSSA-N |
| XLogP | 4.13 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.08 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|