C29H32N6O3 — CID 167542651
(7S,8R)-2-[[5-(1-azido-1-cyclopropylethyl)-8-(3-methylcyclobutyl)oxy-2,7-naphthyridin-3-yl]methyl]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one (PubChem CID 167542651) has the molecular formula C29H32N6O3 and a molecular weight of 512.61 g/mol. Its IUPAC name is (7S,8R)-2-[[5-(1-azido-1-cyclopropylethyl)-8-(3-methylcyclobutyl)oxy-2,7-naphthyridin-3-yl]methyl]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one.
| Compound Name | (7S,8R)-2-[[5-(1-azido-1-cyclopropylethyl)-8-(3-methylcyclobutyl)oxy-2,7-naphthyridin-3-yl]methyl]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 167542651 |
| Molecular Formula | C29H32N6O3 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | (7S,8R)-2-[[5-(1-azido-1-cyclopropylethyl)-8-(3-methylcyclobutyl)oxy-2,7-naphthyridin-3-yl]methyl]-7,8-dimethyl-7,8-dihydropyrano[4,3-b]pyridin-5-one |
| SMILES | CC1CC(Oc2ncc(C(C)(N=[N+]=[N-])C3CC3)c3cc(Cc4ccc5c(n4)[C@@H](C)[C@H](C)OC5=O)ncc23)C1 |
| InChI | InChI=1S/C29H32N6O3/c1-15-9-21(10-15)38-27-24-13-31-20(11-19-7-8-22-26(33-19)16(2)17(3)37-28(22)36)12-23(24)25(14-32-27)29(4,34-35-30)18-5-6-18/h7-8,12-18,21H,5-6,9-11H2,1-4H3/t15?,16-,17-,21?,29?/m0/s1 |
| InChIKey | OTZRNDSSFSUNFD-KQEZGQLFSA-N |
| XLogP | 6.39 |
| TPSA | 122.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|