C35H49NO9S2 — CID 123626538
6-[5-(dithiolan-3-yl)pentanoylamino]hexyl (1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl) carbonate (PubChem CID 123626538) has the molecular formula C35H49NO9S2 and a molecular weight of 691.91 g/mol. Its IUPAC name is 6-[5-(dithiolan-3-yl)pentanoylamino]hexyl (1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl) carbonate.
| Compound Name | 6-[5-(dithiolan-3-yl)pentanoylamino]hexyl (1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl) carbonate |
|---|---|
| PubChem CID | 123626538 |
| Molecular Formula | C35H49NO9S2 |
| Molecular Weight | 691.91 g/mol |
| Exact Mass | 691.28 |
| IUPAC Name | 6-[5-(dithiolan-3-yl)pentanoylamino]hexyl (1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl) carbonate |
| SMILES | CC(C)C12OC1C1OC13C1(C)CCC4=C(COC4=O)C1CC1OC13C2OC(=O)OCCCCCCNC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C35H49NO9S2/c1-20(2)33-27(44-33)28-35(45-28)32(3)14-12-22-23(19-41-29(22)38)24(32)18-25-34(35,43-25)30(33)42-31(39)40-16-9-5-4-8-15-36-26(37)11-7-6-10-21-13-17-46-47-21/h20-21,24-25,27-28,30H,4-19H2,1-3H3,(H,36,37) |
| InChIKey | XBAWRPUFJHBRIC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.91 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|