C9H13N3O4 — CID 123627599
ethyl 2-[5-(aminomethyl)-2,4-dioxopyrimidin-1-yl]acetate (PubChem CID 123627599) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is ethyl 2-[5-(aminomethyl)-2,4-dioxopyrimidin-1-yl]acetate.
| Compound Name | ethyl 2-[5-(aminomethyl)-2,4-dioxopyrimidin-1-yl]acetate |
|---|---|
| PubChem CID | 123627599 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | ethyl 2-[5-(aminomethyl)-2,4-dioxopyrimidin-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(CN)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H13N3O4/c1-2-16-7(13)5-12-4-6(3-10)8(14)11-9(12)15/h4H,2-3,5,10H2,1H3,(H,11,14,15) |
| InChIKey | ARUMYNOFPBXKLH-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |