C21H16F4N2O — CID 123628146
2-(fluoromethyl)-N-[4-(2-methylphenyl)-3-pyridinyl]-5-(trifluoromethyl)benzamide (PubChem CID 123628146) has the molecular formula C21H16F4N2O and a molecular weight of 388.36 g/mol. Its IUPAC name is 2-(fluoromethyl)-N-[4-(2-methylphenyl)-3-pyridinyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-(fluoromethyl)-N-[4-(2-methylphenyl)-3-pyridinyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 123628146 |
| Molecular Formula | C21H16F4N2O |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2-(fluoromethyl)-N-[4-(2-methylphenyl)-3-pyridinyl]-5-(trifluoromethyl)benzamide |
| SMILES | Cc1ccccc1-c1ccncc1NC(=O)c1cc(C(F)(F)F)ccc1CF |
| InChI | InChI=1S/C21H16F4N2O/c1-13-4-2-3-5-16(13)17-8-9-26-12-19(17)27-20(28)18-10-15(21(23,24)25)7-6-14(18)11-22/h2-10,12H,11H2,1H3,(H,27,28) |
| InChIKey | FHTHOOMHGMBVDZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |