C36H35N3O4 — CID 123630435
2-[6-[3-methanimidoyl-4-(methylamino)phenyl]-3-methyl-1-[11-[(2-methylpropan-2-yl)oxy]-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-10-yl]naphthalen-2-yl]acetic acid (PubChem CID 123630435) has the molecular formula C36H35N3O4 and a molecular weight of 573.69 g/mol. Its IUPAC name is 2-[6-[3-methanimidoyl-4-(methylamino)phenyl]-3-methyl-1-[11-[(2-methylpropan-2-yl)oxy]-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-10-yl]naphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-[3-methanimidoyl-4-(methylamino)phenyl]-3-methyl-1-[11-[(2-methylpropan-2-yl)oxy]-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-10-yl]naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 123630435 |
| Molecular Formula | C36H35N3O4 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | 2-[6-[3-methanimidoyl-4-(methylamino)phenyl]-3-methyl-1-[11-[(2-methylpropan-2-yl)oxy]-2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-10-yl]naphthalen-2-yl]acetic acid |
| SMILES | [H]/N=C/c1cc(-c2ccc3c(-c4c(OC(C)(C)C)cc5c6c(ccnc46)CCO5)c(CC(=O)O)c(C)cc3c2)ccc1NC |
| InChI | InChI=1S/C36H35N3O4/c1-20-14-24-15-22(23-7-9-28(38-5)25(16-23)19-37)6-8-26(24)33(27(20)17-31(40)41)34-30(43-36(2,3)4)18-29-32-21(11-13-42-29)10-12-39-35(32)34/h6-10,12,14-16,18-19,37-38H,11,13,17H2,1-5H3,(H,40,41)/b37-19+ |
| InChIKey | LSYLIPJAURGQDB-SAEPALGJSA-N |
| XLogP | 7.81 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|