C37H37N3O3 — CID 118027199
1-[6-[3-methanimidoyl-4-(methylamino)phenyl]-3-methyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-1-[(2-methylpropan-2-yl)oxy]propan-2-one (PubChem CID 118027199) has the molecular formula C37H37N3O3 and a molecular weight of 571.72 g/mol. Its IUPAC name is 1-[6-[3-methanimidoyl-4-(methylamino)phenyl]-3-methyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-1-[(2-methylpropan-2-yl)oxy]propan-2-one.
| Compound Name | 1-[6-[3-methanimidoyl-4-(methylamino)phenyl]-3-methyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-1-[(2-methylpropan-2-yl)oxy]propan-2-one |
|---|---|
| PubChem CID | 118027199 |
| Molecular Formula | C37H37N3O3 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 1-[6-[3-methanimidoyl-4-(methylamino)phenyl]-3-methyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-1-[(2-methylpropan-2-yl)oxy]propan-2-one |
| SMILES | [H]/N=C/c1cc(-c2ccc3c(-c4ccc5c6c(ccnc46)CCO5)c(C(OC(C)(C)C)C(C)=O)c(C)cc3c2)ccc1NC |
| InChI | InChI=1S/C37H37N3O3/c1-21-17-26-18-24(25-8-11-30(39-6)27(19-25)20-38)7-9-28(26)34(32(21)36(22(2)41)43-37(3,4)5)29-10-12-31-33-23(14-16-42-31)13-15-40-35(29)33/h7-13,15,17-20,36,38-39H,14,16H2,1-6H3/b38-20+ |
| InChIKey | VJYPEGODUPEYKX-CHSHITCJSA-N |
| XLogP | 8.45 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|