C10H15F3NO2+ — CID 123631808
ethyl 1-methylidene-2-(2,2,2-trifluoroethyl)pyrrolidin-1-ium-2-carboxylate (PubChem CID 123631808) has the molecular formula C10H15F3NO2+ and a molecular weight of 238.23 g/mol. Its IUPAC name is ethyl 1-methylidene-2-(2,2,2-trifluoroethyl)pyrrolidin-1-ium-2-carboxylate.
| Compound Name | ethyl 1-methylidene-2-(2,2,2-trifluoroethyl)pyrrolidin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 123631808 |
| Molecular Formula | C10H15F3NO2+ |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | ethyl 1-methylidene-2-(2,2,2-trifluoroethyl)pyrrolidin-1-ium-2-carboxylate |
| SMILES | C=[N+]1CCCC1(CC(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C10H15F3NO2/c1-3-16-8(15)9(7-10(11,12)13)5-4-6-14(9)2/h2-7H2,1H3/q+1 |
| InChIKey | SVVGQNMMQQXCRY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|