C8H19N3O3S — CID 123633579
2-[2-(2-azidoethoxy)ethoxy]ethyl-hydroxy-dimethyl-λ4-sulfane (PubChem CID 123633579) has the molecular formula C8H19N3O3S and a molecular weight of 237.32 g/mol. Its IUPAC name is 2-[2-(2-azidoethoxy)ethoxy]ethyl-hydroxy-dimethyl-λ4-sulfane.
| Compound Name | 2-[2-(2-azidoethoxy)ethoxy]ethyl-hydroxy-dimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 123633579 |
| Molecular Formula | C8H19N3O3S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 2-[2-(2-azidoethoxy)ethoxy]ethyl-hydroxy-dimethyl-λ4-sulfane |
| SMILES | CS(C)(O)CCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C8H19N3O3S/c1-15(2,12)8-7-14-6-5-13-4-3-10-11-9/h12H,3-8H2,1-2H3 |
| InChIKey | BCUXJDNIAYEGJP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|