C20H44N6O14S2 — CID 159865353
1-azido-2-[2-(2-azidoethoxy)ethoxy]ethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-[2-(2-methylsulfonyloxyethoxy)ethoxy]ethyl methanesulfonate (PubChem CID 159865353) has the molecular formula C20H44N6O14S2 and a molecular weight of 656.73 g/mol. Its IUPAC name is 1-azido-2-[2-(2-azidoethoxy)ethoxy]ethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-[2-(2-methylsulfonyloxyethoxy)ethoxy]ethyl methanesulfonate.
| Compound Name | 1-azido-2-[2-(2-azidoethoxy)ethoxy]ethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-[2-(2-methylsulfonyloxyethoxy)ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 159865353 |
| Molecular Formula | C20H44N6O14S2 |
| Molecular Weight | 656.73 g/mol |
| Exact Mass | 656.24 |
| IUPAC Name | 1-azido-2-[2-(2-azidoethoxy)ethoxy]ethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-[2-(2-methylsulfonyloxyethoxy)ethoxy]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCOCCOCCOS(C)(=O)=O.OCCOCCOCCO.[N-]=[N+]=NCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C8H18O8S2.C6H12N6O2.C6H14O4/c1-17(9,10)15-7-5-13-3-4-14-6-8-16-18(2,11)12;7-11-9-1-3-13-5-6-14-4-2-10-12-8;7-1-3-9-5-6-10-4-2-8/h3-8H2,1-2H3;1-6H2;7-8H,1-6H2 |
| InChIKey | NRQWVBDZBNKLHD-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 280.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.73 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|