C29H40O17 — CID 123634174
[3,4,5-triacetyloxy-6-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxyoxan-2-yl]methyl 2-methylprop-2-enoate (PubChem CID 123634174) has the molecular formula C29H40O17 and a molecular weight of 660.62 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxyoxan-2-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [3,4,5-triacetyloxy-6-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxyoxan-2-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123634174 |
| Molecular Formula | C29H40O17 |
| Molecular Weight | 660.62 g/mol |
| Exact Mass | 660.23 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxyoxan-2-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1OC(OC2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C2C)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C29H40O17/c1-12(2)27(36)38-11-21-24(41-17(7)33)25(42-18(8)34)26(43-19(9)35)29(45-21)46-28-13(3)22(39-15(5)31)23(40-16(6)32)20(44-28)10-37-14(4)30/h13,20-26,28-29H,1,10-11H2,2-9H3 |
| InChIKey | CVMRRIMXEVCMIL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 211.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.62 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|