C20H19N2O4- — CID 1236346
(Z)-4-(2-morpholin-4-ylanilino)-4-oxo-3-phenylbut-2-enoate (PubChem CID 1236346) has the molecular formula C20H19N2O4- and a molecular weight of 351.38 g/mol. Its IUPAC name is (Z)-4-(2-morpholin-4-ylanilino)-4-oxo-3-phenylbut-2-enoate.
| Compound Name | (Z)-4-(2-morpholin-4-ylanilino)-4-oxo-3-phenylbut-2-enoate |
|---|---|
| PubChem CID | 1236346 |
| Molecular Formula | C20H19N2O4- |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (Z)-4-(2-morpholin-4-ylanilino)-4-oxo-3-phenylbut-2-enoate |
| SMILES | O=C([O-])/C=C(\C(=O)Nc1ccccc1N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O4/c23-19(24)14-16(15-6-2-1-3-7-15)20(25)21-17-8-4-5-9-18(17)22-10-12-26-13-11-22/h1-9,14H,10-13H2,(H,21,25)(H,23,24)/p-1/b16-14- |
| InChIKey | SNWHCJGUOGOXMC-PEZBUJJGSA-M |
| XLogP | 1.30 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|