C22H17NO3 — CID 123634709
2-hydroxy-5-[8-[(3E)-5-nitrosopenta-1,3-dien-3-yl]naphthalen-1-yl]benzaldehyde (PubChem CID 123634709) has the molecular formula C22H17NO3 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-hydroxy-5-[8-[(3E)-5-nitrosopenta-1,3-dien-3-yl]naphthalen-1-yl]benzaldehyde.
| Compound Name | 2-hydroxy-5-[8-[(3E)-5-nitrosopenta-1,3-dien-3-yl]naphthalen-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 123634709 |
| Molecular Formula | C22H17NO3 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-hydroxy-5-[8-[(3E)-5-nitrosopenta-1,3-dien-3-yl]naphthalen-1-yl]benzaldehyde |
| SMILES | C=C/C(=C\CN=O)c1cccc2cccc(-c3ccc(O)c(C=O)c3)c12 |
| InChI | InChI=1S/C22H17NO3/c1-2-15(11-12-23-26)19-7-3-5-16-6-4-8-20(22(16)19)17-9-10-21(25)18(13-17)14-24/h2-11,13-14,25H,1,12H2/b15-11+ |
| InChIKey | AWSTWYMUTMBTNO-RVDMUPIBSA-N |
| XLogP | 5.36 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|