C31H16N2O6 — CID 171392065
5-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-dioxobenzo[de]isoquinolin-6-yl]-2-hydroxybenzaldehyde (PubChem CID 171392065) has the molecular formula C31H16N2O6 and a molecular weight of 512.48 g/mol. Its IUPAC name is 5-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-dioxobenzo[de]isoquinolin-6-yl]-2-hydroxybenzaldehyde.
| Compound Name | 5-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-dioxobenzo[de]isoquinolin-6-yl]-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 171392065 |
| Molecular Formula | C31H16N2O6 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | 5-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-dioxobenzo[de]isoquinolin-6-yl]-2-hydroxybenzaldehyde |
| SMILES | O=Cc1cc(-c2ccc3c4c(cccc24)C(=O)N(N2C(=O)c4cccc5cccc(c45)C2=O)C3=O)ccc1O |
| InChI | InChI=1S/C31H16N2O6/c34-15-18-14-17(10-13-25(18)35)19-11-12-24-27-20(19)6-3-9-23(27)30(38)33(31(24)39)32-28(36)21-7-1-4-16-5-2-8-22(26(16)21)29(32)37/h1-15,35H |
| InChIKey | ZKDKMERXGHZHEX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|