C14H26N4 — CID 123634792
N,N'-di(piperidin-1-yl)butane-1,4-diimine (PubChem CID 123634792) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is N,N'-di(piperidin-1-yl)butane-1,4-diimine.
| Compound Name | N,N'-di(piperidin-1-yl)butane-1,4-diimine |
|---|---|
| PubChem CID | 123634792 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | N,N'-di(piperidin-1-yl)butane-1,4-diimine |
| SMILES | C(CCC=NN1CCCCC1)=NN1CCCCC1 |
| InChI | InChI=1S/C14H26N4/c1-5-11-17(12-6-1)15-9-3-4-10-16-18-13-7-2-8-14-18/h9-10H,1-8,11-14H2 |
| InChIKey | SUEOHPWYEIJYGA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|