C12H21N5 — CID 123635075
4-ethenyl-N,N,4-trimethyl-6-pyrrolidin-1-yl-1H-1,3,5-triazin-2-amine (PubChem CID 123635075) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-ethenyl-N,N,4-trimethyl-6-pyrrolidin-1-yl-1H-1,3,5-triazin-2-amine.
| Compound Name | 4-ethenyl-N,N,4-trimethyl-6-pyrrolidin-1-yl-1H-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123635075 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 4-ethenyl-N,N,4-trimethyl-6-pyrrolidin-1-yl-1H-1,3,5-triazin-2-amine |
| SMILES | C=CC1(C)N=C(N(C)C)NC(N2CCCC2)=N1 |
| InChI | InChI=1S/C12H21N5/c1-5-12(2)14-10(16(3)4)13-11(15-12)17-8-6-7-9-17/h5H,1,6-9H2,2-4H3,(H,13,14,15) |
| InChIKey | DMMDISSICQVACQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|