C9H17N5 — CID 154022292
4-methyl-6-pyrrolidin-1-yl-1H-pyrimidine-2,4-diamine (PubChem CID 154022292) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-methyl-6-pyrrolidin-1-yl-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-methyl-6-pyrrolidin-1-yl-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 154022292 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 4-methyl-6-pyrrolidin-1-yl-1H-pyrimidine-2,4-diamine |
| SMILES | CC1(N)C=C(N2CCCC2)NC(N)=N1 |
| InChI | InChI=1S/C9H17N5/c1-9(11)6-7(12-8(10)13-9)14-4-2-3-5-14/h6H,2-5,11H2,1H3,(H3,10,12,13) |
| InChIKey | HWZRIVDUESLLDO-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |