C16H27N4O+ — CID 123635147
[2-(cyclobutylamino)-6-morpholin-4-yl-4-pyridinyl]-trimethylazanium (PubChem CID 123635147) has the molecular formula C16H27N4O+ and a molecular weight of 291.42 g/mol. Its IUPAC name is [2-(cyclobutylamino)-6-morpholin-4-yl-4-pyridinyl]-trimethylazanium.
| Compound Name | [2-(cyclobutylamino)-6-morpholin-4-yl-4-pyridinyl]-trimethylazanium |
|---|---|
| PubChem CID | 123635147 |
| Molecular Formula | C16H27N4O+ |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | [2-(cyclobutylamino)-6-morpholin-4-yl-4-pyridinyl]-trimethylazanium |
| SMILES | C[N+](C)(C)c1cc(NC2CCC2)nc(N2CCOCC2)c1 |
| InChI | InChI=1S/C16H27N4O/c1-20(2,3)14-11-15(17-13-5-4-6-13)18-16(12-14)19-7-9-21-10-8-19/h11-13H,4-10H2,1-3H3,(H,17,18)/q+1 |
| InChIKey | DDWJJGVEYOHBRL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|