C32H49FI2N6O4 — CID 159954649
4-amino-1-methylcyclohexan-1-ol;4-(6-fluoro-4-iodo-2-pyridinyl)morpholine;4-[(4-iodo-6-morpholin-4-yl-2-pyridinyl)amino]-1-methylcyclohexan-1-ol (PubChem CID 159954649) has the molecular formula C32H49FI2N6O4 and a molecular weight of 854.59 g/mol. Its IUPAC name is 4-amino-1-methylcyclohexan-1-ol;4-(6-fluoro-4-iodo-2-pyridinyl)morpholine;4-[(4-iodo-6-morpholin-4-yl-2-pyridinyl)amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-amino-1-methylcyclohexan-1-ol;4-(6-fluoro-4-iodo-2-pyridinyl)morpholine;4-[(4-iodo-6-morpholin-4-yl-2-pyridinyl)amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 159954649 |
| Molecular Formula | C32H49FI2N6O4 |
| Molecular Weight | 854.59 g/mol |
| Exact Mass | 854.19 |
| IUPAC Name | 4-amino-1-methylcyclohexan-1-ol;4-(6-fluoro-4-iodo-2-pyridinyl)morpholine;4-[(4-iodo-6-morpholin-4-yl-2-pyridinyl)amino]-1-methylcyclohexan-1-ol |
| SMILES | CC1(O)CCC(N)CC1.CC1(O)CCC(Nc2cc(I)cc(N3CCOCC3)n2)CC1.Fc1cc(I)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H24IN3O2.C9H10FIN2O.C7H15NO/c1-16(21)4-2-13(3-5-16)18-14-10-12(17)11-15(19-14)20-6-8-22-9-7-20;10-8-5-7(11)6-9(12-8)13-1-3-14-4-2-13;1-7(9)4-2-6(8)3-5-7/h10-11,13,21H,2-9H2,1H3,(H,18,19);5-6H,1-4H2;6,9H,2-5,8H2,1H3 |
| InChIKey | OCOCVBYKPFBWND-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|