C27H33NO16 — CID 123635801
4-hydroxy-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-5-nitroso-4,6-bis[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexane-1,3-dione (PubChem CID 123635801) has the molecular formula C27H33NO16 and a molecular weight of 627.55 g/mol. Its IUPAC name is 4-hydroxy-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-5-nitroso-4,6-bis[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexane-1,3-dione.
| Compound Name | 4-hydroxy-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-5-nitroso-4,6-bis[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 123635801 |
| Molecular Formula | C27H33NO16 |
| Molecular Weight | 627.55 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | 4-hydroxy-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-5-nitroso-4,6-bis[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexane-1,3-dione |
| SMILES | O=NC1C(C2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)C(C(=O)/C=C/c2ccc(O)cc2)C(=O)C1(O)C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H33NO16/c29-7-12-16(33)19(36)21(38)23(43-12)15-18(35)14(11(32)6-3-9-1-4-10(31)5-2-9)25(40)27(41,24(15)28-42)26-22(39)20(37)17(34)13(8-30)44-26/h1-6,12-17,19-24,26,29-31,33-34,36-39,41H,7-8H2/b6-3+/t12-,13-,14?,15?,16-,17-,19+,20+,21-,22-,23?,24?,26?,27?/m1/s1 |
| InChIKey | QONHAPPUPFZELI-HMJKJBNXSA-N |
| XLogP | -5.09 |
| TPSA | 301.40 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.55 |
| LogP ≤ 5 | -5.09 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|