C10H11N3 — CID 123636454
4-(azetidin-1-yl)-7-azabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-3-amine (PubChem CID 123636454) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 4-(azetidin-1-yl)-7-azabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-3-amine.
| Compound Name | 4-(azetidin-1-yl)-7-azabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 123636454 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 4-(azetidin-1-yl)-7-azabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-3-amine |
| SMILES | Nc1cc2c(cc1N1CCC1)=NC=2 |
| InChI | InChI=1S/C10H11N3/c11-8-4-7-6-12-9(7)5-10(8)13-2-1-3-13/h4-6H,1-3,11H2 |
| InChIKey | SUJZRYOPVXTGKY-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|