C11H13N3 — CID 123899536
4-N-methyl-4-N-prop-2-enyl-7-azabicyclo[4.2.0]octa-1(8),2,4,6-tetraene-3,4-diamine (PubChem CID 123899536) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 4-N-methyl-4-N-prop-2-enyl-7-azabicyclo[4.2.0]octa-1(8),2,4,6-tetraene-3,4-diamine.
| Compound Name | 4-N-methyl-4-N-prop-2-enyl-7-azabicyclo[4.2.0]octa-1(8),2,4,6-tetraene-3,4-diamine |
|---|---|
| PubChem CID | 123899536 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 4-N-methyl-4-N-prop-2-enyl-7-azabicyclo[4.2.0]octa-1(8),2,4,6-tetraene-3,4-diamine |
| SMILES | C=CCN(C)c1cc2c(cc1N)=CN=2 |
| InChI | InChI=1S/C11H13N3/c1-3-4-14(2)11-6-10-8(7-13-10)5-9(11)12/h3,5-7H,1,4,12H2,2H3 |
| InChIKey | AHGIDIVKZFHSNF-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|