C15H18N3O6+ — CID 123637607
1-benzyl-5-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-1-ium-2,4-dione (PubChem CID 123637607) has the molecular formula C15H18N3O6+ and a molecular weight of 336.32 g/mol. Its IUPAC name is 1-benzyl-5-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-1-ium-2,4-dione.
| Compound Name | 1-benzyl-5-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 123637607 |
| Molecular Formula | C15H18N3O6+ |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-benzyl-5-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-1-ium-2,4-dione |
| SMILES | O=c1[nH]c(=O)[n+](Cc2ccccc2)cn1[C@@H]1O[C@H](CO)[C@H](O)C1O |
| InChI | InChI=1S/C15H17N3O6/c19-7-10-11(20)12(21)13(24-10)18-8-17(14(22)16-15(18)23)6-9-4-2-1-3-5-9/h1-5,8,10-13,19-21H,6-7H2/p+1/t10-,11+,12?,13-/m1/s1 |
| InChIKey | LJYXVLUIBSOWBW-ZGVCCVRISA-O |
| XLogP | -2.52 |
| TPSA | 128.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|