About (2E)-2-ethanimidoyl-4-fluoropenta-2,4-dienamide
(2E)-2-ethanimidoyl-4-fluoropenta-2,4-dienamide (PubChem CID 123637841) has the molecular formula C7H9FN2O
and a molecular weight of 156.16 g/mol. Its IUPAC name is (2E)-2-ethanimidoyl-4-fluoropenta-2,4-dienamide.
Molecular Properties
| Compound Name | (2E)-2-ethanimidoyl-4-fluoropenta-2,4-dienamide |
| PubChem CID | 123637841 |
| Molecular Formula | C7H9FN2O |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | (2E)-2-ethanimidoyl-4-fluoropenta-2,4-dienamide |
| SMILES | [H]/N=C(C)/C(=C\C(=C)F)C(N)=O |
| InChI | InChI=1S/C7H9FN2O/c1-4(8)3-6(5(2)9)7(10)11/h3,9H,1H2,2H3,(H2,10,11)/b6-3+,9-5+ |
| InChIKey | PONNWNMCRTVWJE-DBKVWBBNSA-N |
| XLogP | 0.92 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-ethanimidoyl-4-fluoropenta-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-ethanimidoyl-4-fluoropenta-2,4-dienamide?
The IUPAC name of (2E)-2-ethanimidoyl-4-fluoropenta-2,4-dienamide (CID 123637841) is (2E)-2-ethanimidoyl-4-fluoropenta-2,4-dienamide.
What is the SMILES notation for (2E)-2-ethanimidoyl-4-fluoropenta-2,4-dienamide?
The canonical SMILES for (2E)-2-ethanimidoyl-4-fluoropenta-2,4-dienamide is [H]/N=C(C)/C(=C\C(=C)F)C(N)=O.
What is the InChIKey of (2E)-2-ethanimidoyl-4-fluoropenta-2,4-dienamide?
The InChIKey is PONNWNMCRTVWJE-DBKVWBBNSA-N. The full InChI is InChI=1S/C7H9FN2O/c1-4(8)3-6(5(2)9)7(10)11/h3,9H,1H2,2H3,(H2,10,11)/b6-3+,9-5+.
What are the key properties of (2E)-2-ethanimidoyl-4-fluoropenta-2,4-dienamide?
(2E)-2-ethanimidoyl-4-fluoropenta-2,4-dienamide has a molecular weight of 156.16 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-ethanimidoyl-4-fluoropenta-2,4-dienamide is sourced from PubChem (CID 123637841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).