C8H9N3O — CID 123649043
(2E)-4-cyano-2-ethanimidoylpenta-2,4-dienamide (PubChem CID 123649043) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is (2E)-4-cyano-2-ethanimidoylpenta-2,4-dienamide.
| Compound Name | (2E)-4-cyano-2-ethanimidoylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 123649043 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | (2E)-4-cyano-2-ethanimidoylpenta-2,4-dienamide |
| SMILES | [H]/N=C(C)/C(=C\C(=C)C#N)C(N)=O |
| InChI | InChI=1S/C8H9N3O/c1-5(4-9)3-7(6(2)10)8(11)12/h3,10H,1H2,2H3,(H2,11,12)/b7-3+,10-6+ |
| InChIKey | UZBCRWQIYRYZNA-ASVGJQBISA-N |
| XLogP | 0.52 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|