C18H16BrN3OS2 — CID 123640349
3-bromo-N-methyl-N-[C-methyl-N-(2-methyl-4-sulfanyl-1,3-benzothiazol-5-yl)carbonimidoyl]benzamide (PubChem CID 123640349) has the molecular formula C18H16BrN3OS2 and a molecular weight of 434.38 g/mol. Its IUPAC name is 3-bromo-N-methyl-N-[C-methyl-N-(2-methyl-4-sulfanyl-1,3-benzothiazol-5-yl)carbonimidoyl]benzamide.
| Compound Name | 3-bromo-N-methyl-N-[C-methyl-N-(2-methyl-4-sulfanyl-1,3-benzothiazol-5-yl)carbonimidoyl]benzamide |
|---|---|
| PubChem CID | 123640349 |
| Molecular Formula | C18H16BrN3OS2 |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 432.99 |
| IUPAC Name | 3-bromo-N-methyl-N-[C-methyl-N-(2-methyl-4-sulfanyl-1,3-benzothiazol-5-yl)carbonimidoyl]benzamide |
| SMILES | C/C(=N\c1ccc2sc(C)nc2c1S)N(C)C(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H16BrN3OS2/c1-10(22(3)18(23)12-5-4-6-13(19)9-12)20-14-7-8-15-16(17(14)24)21-11(2)25-15/h4-9,24H,1-3H3/b20-10+ |
| InChIKey | FOHSDAWRLLZZNX-KEBDBYFISA-N |
| XLogP | 5.48 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|