C27H26ClN3O3 — CID 123642268
N-[4-(3-benzyl-3-methyl-2,5-dioxo-4-propylpyrrolidin-1-yl)-3-chlorophenyl]pyridine-2-carboxamide (PubChem CID 123642268) has the molecular formula C27H26ClN3O3 and a molecular weight of 475.98 g/mol. Its IUPAC name is N-[4-(3-benzyl-3-methyl-2,5-dioxo-4-propylpyrrolidin-1-yl)-3-chlorophenyl]pyridine-2-carboxamide.
| Compound Name | N-[4-(3-benzyl-3-methyl-2,5-dioxo-4-propylpyrrolidin-1-yl)-3-chlorophenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123642268 |
| Molecular Formula | C27H26ClN3O3 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | N-[4-(3-benzyl-3-methyl-2,5-dioxo-4-propylpyrrolidin-1-yl)-3-chlorophenyl]pyridine-2-carboxamide |
| SMILES | CCCC1C(=O)N(c2ccc(NC(=O)c3ccccn3)cc2Cl)C(=O)C1(C)Cc1ccccc1 |
| InChI | InChI=1S/C27H26ClN3O3/c1-3-9-20-25(33)31(26(34)27(20,2)17-18-10-5-4-6-11-18)23-14-13-19(16-21(23)28)30-24(32)22-12-7-8-15-29-22/h4-8,10-16,20H,3,9,17H2,1-2H3,(H,30,32) |
| InChIKey | YKISGEVCHNEQTP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|