C24H20ClN3O3S — CID 123947930
N-[4-(3-benzyl-3,4-dimethyl-2,6-dioxo-1-pyridinyl)-3-chlorophenyl]-1,3-thiazole-2-carboxamide (PubChem CID 123947930) has the molecular formula C24H20ClN3O3S and a molecular weight of 465.96 g/mol. Its IUPAC name is N-[4-(3-benzyl-3,4-dimethyl-2,6-dioxo-1-pyridinyl)-3-chlorophenyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-[4-(3-benzyl-3,4-dimethyl-2,6-dioxo-1-pyridinyl)-3-chlorophenyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 123947930 |
| Molecular Formula | C24H20ClN3O3S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | N-[4-(3-benzyl-3,4-dimethyl-2,6-dioxo-1-pyridinyl)-3-chlorophenyl]-1,3-thiazole-2-carboxamide |
| SMILES | CC1=CC(=O)N(c2ccc(NC(=O)c3nccs3)cc2Cl)C(=O)C1(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H20ClN3O3S/c1-15-12-20(29)28(23(31)24(15,2)14-16-6-4-3-5-7-16)19-9-8-17(13-18(19)25)27-21(30)22-26-10-11-32-22/h3-13H,14H2,1-2H3,(H,27,30) |
| InChIKey | ONQRFWFMBVNJBR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|