C25H21ClFN3O4 — CID 123642378
5-[[6-chloro-5-[6-fluoro-1-(2-hydroxyethyl)indol-5-yl]-6,7-dihydro-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid (PubChem CID 123642378) has the molecular formula C25H21ClFN3O4 and a molecular weight of 481.91 g/mol. Its IUPAC name is 5-[[6-chloro-5-[6-fluoro-1-(2-hydroxyethyl)indol-5-yl]-6,7-dihydro-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid.
| Compound Name | 5-[[6-chloro-5-[6-fluoro-1-(2-hydroxyethyl)indol-5-yl]-6,7-dihydro-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 123642378 |
| Molecular Formula | C25H21ClFN3O4 |
| Molecular Weight | 481.91 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 5-[[6-chloro-5-[6-fluoro-1-(2-hydroxyethyl)indol-5-yl]-6,7-dihydro-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid |
| SMILES | Cc1ccc(Oc2nc3c([nH]2)CC(Cl)C(c2cc4ccn(CCO)c4cc2F)=C3)cc1C(=O)O |
| InChI | InChI=1S/C25H21ClFN3O4/c1-13-2-3-15(9-16(13)24(32)33)34-25-28-21-10-17(19(26)11-22(21)29-25)18-8-14-4-5-30(6-7-31)23(14)12-20(18)27/h2-5,8-10,12,19,31H,6-7,11H2,1H3,(H,28,29)(H,32,33) |
| InChIKey | XDQFRJCTCWEOIG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.91 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|