C20H19ClFN7O3 — CID 123642839
4-N-[6-[(2-chloro-4-fluorobenzoyl)amino]-3-pyridinyl]-5-N-[2-(methylamino)ethyl]-1H-imidazole-4,5-dicarboxamide (PubChem CID 123642839) has the molecular formula C20H19ClFN7O3 and a molecular weight of 459.87 g/mol. Its IUPAC name is 4-N-[6-[(2-chloro-4-fluorobenzoyl)amino]-3-pyridinyl]-5-N-[2-(methylamino)ethyl]-1H-imidazole-4,5-dicarboxamide.
| Compound Name | 4-N-[6-[(2-chloro-4-fluorobenzoyl)amino]-3-pyridinyl]-5-N-[2-(methylamino)ethyl]-1H-imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 123642839 |
| Molecular Formula | C20H19ClFN7O3 |
| Molecular Weight | 459.87 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 4-N-[6-[(2-chloro-4-fluorobenzoyl)amino]-3-pyridinyl]-5-N-[2-(methylamino)ethyl]-1H-imidazole-4,5-dicarboxamide |
| SMILES | CNCCNC(=O)c1[nH]cnc1C(=O)Nc1ccc(NC(=O)c2ccc(F)cc2Cl)nc1 |
| InChI | InChI=1S/C20H19ClFN7O3/c1-23-6-7-24-19(31)16-17(27-10-26-16)20(32)28-12-3-5-15(25-9-12)29-18(30)13-4-2-11(22)8-14(13)21/h2-5,8-10,23H,6-7H2,1H3,(H,24,31)(H,26,27)(H,28,32)(H,25,29,30) |
| InChIKey | SLHBXVLHXCDTEE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 140.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.87 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|