C21H22ClFN8O3 — CID 144936528
4-N-[4-[(2-chloro-4-fluorobenzoyl)amino]phenyl]-5-N-[2,2-diamino-2-(methylamino)ethyl]-1H-imidazole-4,5-dicarboxamide (PubChem CID 144936528) has the molecular formula C21H22ClFN8O3 and a molecular weight of 488.91 g/mol. Its IUPAC name is 4-N-[4-[(2-chloro-4-fluorobenzoyl)amino]phenyl]-5-N-[2,2-diamino-2-(methylamino)ethyl]-1H-imidazole-4,5-dicarboxamide.
| Compound Name | 4-N-[4-[(2-chloro-4-fluorobenzoyl)amino]phenyl]-5-N-[2,2-diamino-2-(methylamino)ethyl]-1H-imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 144936528 |
| Molecular Formula | C21H22ClFN8O3 |
| Molecular Weight | 488.91 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 4-N-[4-[(2-chloro-4-fluorobenzoyl)amino]phenyl]-5-N-[2,2-diamino-2-(methylamino)ethyl]-1H-imidazole-4,5-dicarboxamide |
| SMILES | CNC(N)(N)CNC(=O)c1[nH]cnc1C(=O)Nc1ccc(NC(=O)c2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C21H22ClFN8O3/c1-26-21(24,25)9-27-19(33)16-17(29-10-28-16)20(34)31-13-5-3-12(4-6-13)30-18(32)14-7-2-11(23)8-15(14)22/h2-8,10,26H,9,24-25H2,1H3,(H,27,33)(H,28,29)(H,30,32)(H,31,34) |
| InChIKey | TUBDOCVCNQHACT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.91 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|