C23H20BrN3O2S — CID 123642974
3-amino-N-[3-(bromomethyl)-4-methylphenyl]-6-(3-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 123642974) has the molecular formula C23H20BrN3O2S and a molecular weight of 482.40 g/mol. Its IUPAC name is 3-amino-N-[3-(bromomethyl)-4-methylphenyl]-6-(3-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[3-(bromomethyl)-4-methylphenyl]-6-(3-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123642974 |
| Molecular Formula | C23H20BrN3O2S |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | 3-amino-N-[3-(bromomethyl)-4-methylphenyl]-6-(3-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | COc1cccc(-c2ccc3c(N)c(C(=O)Nc4ccc(C)c(CBr)c4)sc3n2)c1 |
| InChI | InChI=1S/C23H20BrN3O2S/c1-13-6-7-16(10-15(13)12-24)26-22(28)21-20(25)18-8-9-19(27-23(18)30-21)14-4-3-5-17(11-14)29-2/h3-11H,12,25H2,1-2H3,(H,26,28) |
| InChIKey | CMVYJKAFULZAFQ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|