C21H16IN3O2S — CID 23745753
3-amino-N-(2-iodophenyl)-6-(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 23745753) has the molecular formula C21H16IN3O2S and a molecular weight of 501.35 g/mol. Its IUPAC name is 3-amino-N-(2-iodophenyl)-6-(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(2-iodophenyl)-6-(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 23745753 |
| Molecular Formula | C21H16IN3O2S |
| Molecular Weight | 501.35 g/mol |
| Exact Mass | 501.00 |
| IUPAC Name | 3-amino-N-(2-iodophenyl)-6-(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | COc1ccc(-c2ccc3c(N)c(C(=O)Nc4ccccc4I)sc3n2)cc1 |
| InChI | InChI=1S/C21H16IN3O2S/c1-27-13-8-6-12(7-9-13)16-11-10-14-18(23)19(28-21(14)25-16)20(26)24-17-5-3-2-4-15(17)22/h2-11H,23H2,1H3,(H,24,26) |
| InChIKey | ICUSYCDSJGMHGF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.35 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|