C15H14N4OS — CID 53270913
3-amino-6-(4-methylphenyl)thieno[2,3-b]pyridine-2-carbohydrazide (PubChem CID 53270913) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is 3-amino-6-(4-methylphenyl)thieno[2,3-b]pyridine-2-carbohydrazide.
| Compound Name | 3-amino-6-(4-methylphenyl)thieno[2,3-b]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 53270913 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 3-amino-6-(4-methylphenyl)thieno[2,3-b]pyridine-2-carbohydrazide |
| SMILES | Cc1ccc(-c2ccc3c(N)c(C(=O)NN)sc3n2)cc1 |
| InChI | InChI=1S/C15H14N4OS/c1-8-2-4-9(5-3-8)11-7-6-10-12(16)13(14(20)19-17)21-15(10)18-11/h2-7H,16-17H2,1H3,(H,19,20) |
| InChIKey | WDUBMMSCFURTDI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|