C14H23ClO3 — CID 123643013
ethyl (4R)-4-[(1R)-2-chloro-1-hydroxyethyl]deca-2,7-dienoate (PubChem CID 123643013) has the molecular formula C14H23ClO3 and a molecular weight of 274.79 g/mol. Its IUPAC name is ethyl (4R)-4-[(1R)-2-chloro-1-hydroxyethyl]deca-2,7-dienoate.
| Compound Name | ethyl (4R)-4-[(1R)-2-chloro-1-hydroxyethyl]deca-2,7-dienoate |
|---|---|
| PubChem CID | 123643013 |
| Molecular Formula | C14H23ClO3 |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | ethyl (4R)-4-[(1R)-2-chloro-1-hydroxyethyl]deca-2,7-dienoate |
| SMILES | CCC=CCC[C@H](C=CC(=O)OCC)[C@@H](O)CCl |
| InChI | InChI=1S/C14H23ClO3/c1-3-5-6-7-8-12(13(16)11-15)9-10-14(17)18-4-2/h5-6,9-10,12-13,16H,3-4,7-8,11H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | WNZLPJIIJYJIBE-OLZOCXBDSA-N |
| XLogP | 3.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|