C12H20O3 — CID 162406237
methyl (2E,4S,5S,6S)-5-hydroxy-4,6-dimethylnona-2,8-dienoate (PubChem CID 162406237) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is methyl (2E,4S,5S,6S)-5-hydroxy-4,6-dimethylnona-2,8-dienoate.
| Compound Name | methyl (2E,4S,5S,6S)-5-hydroxy-4,6-dimethylnona-2,8-dienoate |
|---|---|
| PubChem CID | 162406237 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | methyl (2E,4S,5S,6S)-5-hydroxy-4,6-dimethylnona-2,8-dienoate |
| SMILES | C=CC[C@H](C)[C@H](O)[C@@H](C)/C=C/C(=O)OC |
| InChI | InChI=1S/C12H20O3/c1-5-6-9(2)12(14)10(3)7-8-11(13)15-4/h5,7-10,12,14H,1,6H2,2-4H3/b8-7+/t9-,10-,12-/m0/s1 |
| InChIKey | VKLSBBRBXQPUNL-SCUUSCMNSA-N |
| XLogP | 1.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|